C11H17NO4 — CID 22255839
2-[N-(2,2-dihydroxyethyl)-4-methylanilino]ethane-1,1-diol (PubChem CID 22255839) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-[N-(2,2-dihydroxyethyl)-4-methylanilino]ethane-1,1-diol.
| Compound Name | 2-[N-(2,2-dihydroxyethyl)-4-methylanilino]ethane-1,1-diol |
|---|---|
| PubChem CID | 22255839 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-[N-(2,2-dihydroxyethyl)-4-methylanilino]ethane-1,1-diol |
| SMILES | Cc1ccc(N(CC(O)O)CC(O)O)cc1 |
| InChI | InChI=1S/C11H17NO4/c1-8-2-4-9(5-3-8)12(6-10(13)14)7-11(15)16/h2-5,10-11,13-16H,6-7H2,1H3 |
| InChIKey | LNXHIGSMICPKJE-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|