C13H21NO8S2 — CID 87235375
2-hydroxy-3-(N-(2-hydroxy-3-sulfopropyl)-4-methylanilino)propane-1-sulfonic acid (PubChem CID 87235375) has the molecular formula C13H21NO8S2 and a molecular weight of 383.44 g/mol. Its IUPAC name is 2-hydroxy-3-(N-(2-hydroxy-3-sulfopropyl)-4-methylanilino)propane-1-sulfonic acid.
| Compound Name | 2-hydroxy-3-(N-(2-hydroxy-3-sulfopropyl)-4-methylanilino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 87235375 |
| Molecular Formula | C13H21NO8S2 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-hydroxy-3-(N-(2-hydroxy-3-sulfopropyl)-4-methylanilino)propane-1-sulfonic acid |
| SMILES | Cc1ccc(N(CC(O)CS(=O)(=O)O)CC(O)CS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C13H21NO8S2/c1-10-2-4-11(5-3-10)14(6-12(15)8-23(17,18)19)7-13(16)9-24(20,21)22/h2-5,12-13,15-16H,6-9H2,1H3,(H,17,18,19)(H,20,21,22) |
| InChIKey | JTFNANBVUXPDKU-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|