C17H29N — CID 138414456
4-methyl-N,N-bis(3-methylbutyl)aniline (PubChem CID 138414456) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 4-methyl-N,N-bis(3-methylbutyl)aniline.
| Compound Name | 4-methyl-N,N-bis(3-methylbutyl)aniline |
|---|---|
| PubChem CID | 138414456 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 4-methyl-N,N-bis(3-methylbutyl)aniline |
| SMILES | Cc1ccc(N(CCC(C)C)CCC(C)C)cc1 |
| InChI | InChI=1S/C17H29N/c1-14(2)10-12-18(13-11-15(3)4)17-8-6-16(5)7-9-17/h6-9,14-15H,10-13H2,1-5H3 |
| InChIKey | OTUVKZNBCQYFQI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|