C11H16NNaO4S — CID 24802127
sodium 3-(N-ethylanilino)-2-hydroxypropane-1-sulfonate (PubChem CID 24802127) has the molecular formula C11H16NNaO4S and a molecular weight of 281.31 g/mol. Its IUPAC name is sodium 3-(N-ethylanilino)-2-hydroxypropane-1-sulfonate.
| Compound Name | sodium 3-(N-ethylanilino)-2-hydroxypropane-1-sulfonate |
|---|---|
| PubChem CID | 24802127 |
| Molecular Formula | C11H16NNaO4S |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | sodium 3-(N-ethylanilino)-2-hydroxypropane-1-sulfonate |
| SMILES | CCN(CC(O)CS(=O)(=O)[O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C11H17NO4S.Na/c1-2-12(10-6-4-3-5-7-10)8-11(13)9-17(14,15)16;/h3-7,11,13H,2,8-9H2,1H3,(H,14,15,16);/q;+1/p-1 |
| InChIKey | YHGXBTQORMEDAM-UHFFFAOYSA-M |
| XLogP | -2.58 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|