C11H16NNaO3S — CID 23685294
sodium 3-(N-ethylanilino)propane-1-sulfonate (PubChem CID 23685294) has the molecular formula C11H16NNaO3S and a molecular weight of 265.31 g/mol. Its IUPAC name is sodium 3-(N-ethylanilino)propane-1-sulfonate.
| Compound Name | sodium 3-(N-ethylanilino)propane-1-sulfonate |
|---|---|
| PubChem CID | 23685294 |
| Molecular Formula | C11H16NNaO3S |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | sodium 3-(N-ethylanilino)propane-1-sulfonate |
| SMILES | CCN(CCCS(=O)(=O)[O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C11H17NO3S.Na/c1-2-12(9-6-10-16(13,14)15)11-7-4-3-5-8-11;/h3-5,7-8H,2,6,9-10H2,1H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | FFJBIXKLISICDT-UHFFFAOYSA-M |
| XLogP | -1.55 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|