C12H18NO5S- — CID 171149360
3-(N-ethyl-3-methoxyanilino)-2-hydroxypropane-1-sulfonate (PubChem CID 171149360) has the molecular formula C12H18NO5S- and a molecular weight of 288.34 g/mol. Its IUPAC name is 3-(N-ethyl-3-methoxyanilino)-2-hydroxypropane-1-sulfonate.
| Compound Name | 3-(N-ethyl-3-methoxyanilino)-2-hydroxypropane-1-sulfonate |
|---|---|
| PubChem CID | 171149360 |
| Molecular Formula | C12H18NO5S- |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-(N-ethyl-3-methoxyanilino)-2-hydroxypropane-1-sulfonate |
| SMILES | CCN(CC(O)CS(=O)(=O)[O-])c1cccc(OC)c1 |
| InChI | InChI=1S/C12H19NO5S/c1-3-13(8-11(14)9-19(15,16)17)10-5-4-6-12(7-10)18-2/h4-7,11,14H,3,8-9H2,1-2H3,(H,15,16,17)/p-1 |
| InChIKey | ZLQNJZKBJSMXCJ-UHFFFAOYSA-M |
| XLogP | 0.43 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|