C18H23NO4S — CID 88817471
2-[(N-butyl-3-methoxyanilino)methyl]benzenesulfonic acid (PubChem CID 88817471) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is 2-[(N-butyl-3-methoxyanilino)methyl]benzenesulfonic acid.
| Compound Name | 2-[(N-butyl-3-methoxyanilino)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 88817471 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-[(N-butyl-3-methoxyanilino)methyl]benzenesulfonic acid |
| SMILES | CCCCN(Cc1ccccc1S(=O)(=O)O)c1cccc(OC)c1 |
| InChI | InChI=1S/C18H23NO4S/c1-3-4-12-19(16-9-7-10-17(13-16)23-2)14-15-8-5-6-11-18(15)24(20,21)22/h5-11,13H,3-4,12,14H2,1-2H3,(H,20,21,22) |
| InChIKey | IZZMNZMOZWAJFE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|