C22H32N2O — CID 142915130
N-[[4-[2-(dimethylamino)-2-methylpropyl]phenyl]methyl]-N-ethyl-3-methoxyaniline (PubChem CID 142915130) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is N-[[4-[2-(dimethylamino)-2-methylpropyl]phenyl]methyl]-N-ethyl-3-methoxyaniline.
| Compound Name | N-[[4-[2-(dimethylamino)-2-methylpropyl]phenyl]methyl]-N-ethyl-3-methoxyaniline |
|---|---|
| PubChem CID | 142915130 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | N-[[4-[2-(dimethylamino)-2-methylpropyl]phenyl]methyl]-N-ethyl-3-methoxyaniline |
| SMILES | CCN(Cc1ccc(CC(C)(C)N(C)C)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C22H32N2O/c1-7-24(20-9-8-10-21(15-20)25-6)17-19-13-11-18(12-14-19)16-22(2,3)23(4)5/h8-15H,7,16-17H2,1-6H3 |
| InChIKey | MVDVONWNCSMIPS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |