C21H30N2O — CID 142915296
N-ethyl-3-methoxy-N-[[4-[2-methyl-1-(methylamino)propan-2-yl]phenyl]methyl]aniline (PubChem CID 142915296) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is N-ethyl-3-methoxy-N-[[4-[2-methyl-1-(methylamino)propan-2-yl]phenyl]methyl]aniline.
| Compound Name | N-ethyl-3-methoxy-N-[[4-[2-methyl-1-(methylamino)propan-2-yl]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 142915296 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | N-ethyl-3-methoxy-N-[[4-[2-methyl-1-(methylamino)propan-2-yl]phenyl]methyl]aniline |
| SMILES | CCN(Cc1ccc(C(C)(C)CNC)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C21H30N2O/c1-6-23(19-8-7-9-20(14-19)24-5)15-17-10-12-18(13-11-17)21(2,3)16-22-4/h7-14,22H,6,15-16H2,1-5H3 |
| InChIKey | UOAODOOAXPAJDU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |