C22H32N2O3 — CID 142915240
N-ethyl-3-methoxy-N-[[4-[2-[2-methoxyethyl(methyl)amino]ethoxy]phenyl]methyl]aniline (PubChem CID 142915240) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-ethyl-3-methoxy-N-[[4-[2-[2-methoxyethyl(methyl)amino]ethoxy]phenyl]methyl]aniline.
| Compound Name | N-ethyl-3-methoxy-N-[[4-[2-[2-methoxyethyl(methyl)amino]ethoxy]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 142915240 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | N-ethyl-3-methoxy-N-[[4-[2-[2-methoxyethyl(methyl)amino]ethoxy]phenyl]methyl]aniline |
| SMILES | CCN(Cc1ccc(OCCN(C)CCOC)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C22H32N2O3/c1-5-24(20-7-6-8-22(17-20)26-4)18-19-9-11-21(12-10-19)27-16-14-23(2)13-15-25-3/h6-12,17H,5,13-16,18H2,1-4H3 |
| InChIKey | HPMGNBDMPVMXMD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |