C21H29FN2O2 — CID 142915200
N-[[3-fluoro-4-[2-[methyl(propyl)amino]ethoxy]phenyl]methyl]-3-methoxy-N-methylaniline (PubChem CID 142915200) has the molecular formula C21H29FN2O2 and a molecular weight of 360.47 g/mol. Its IUPAC name is N-[[3-fluoro-4-[2-[methyl(propyl)amino]ethoxy]phenyl]methyl]-3-methoxy-N-methylaniline.
| Compound Name | N-[[3-fluoro-4-[2-[methyl(propyl)amino]ethoxy]phenyl]methyl]-3-methoxy-N-methylaniline |
|---|---|
| PubChem CID | 142915200 |
| Molecular Formula | C21H29FN2O2 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | N-[[3-fluoro-4-[2-[methyl(propyl)amino]ethoxy]phenyl]methyl]-3-methoxy-N-methylaniline |
| SMILES | CCCN(C)CCOc1ccc(CN(C)c2cccc(OC)c2)cc1F |
| InChI | InChI=1S/C21H29FN2O2/c1-5-11-23(2)12-13-26-21-10-9-17(14-20(21)22)16-24(3)18-7-6-8-19(15-18)25-4/h6-10,14-15H,5,11-13,16H2,1-4H3 |
| InChIKey | PXCNJVQAONTUEO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |