C21H27FN2O2 — CID 142915056
N-[[4-[2-(azetidin-1-yl)ethoxy]-3-fluorophenyl]methyl]-N-ethyl-3-methoxyaniline (PubChem CID 142915056) has the molecular formula C21H27FN2O2 and a molecular weight of 358.46 g/mol. Its IUPAC name is N-[[4-[2-(azetidin-1-yl)ethoxy]-3-fluorophenyl]methyl]-N-ethyl-3-methoxyaniline.
| Compound Name | N-[[4-[2-(azetidin-1-yl)ethoxy]-3-fluorophenyl]methyl]-N-ethyl-3-methoxyaniline |
|---|---|
| PubChem CID | 142915056 |
| Molecular Formula | C21H27FN2O2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | N-[[4-[2-(azetidin-1-yl)ethoxy]-3-fluorophenyl]methyl]-N-ethyl-3-methoxyaniline |
| SMILES | CCN(Cc1ccc(OCCN2CCC2)c(F)c1)c1cccc(OC)c1 |
| InChI | InChI=1S/C21H27FN2O2/c1-3-24(18-6-4-7-19(15-18)25-2)16-17-8-9-21(20(22)14-17)26-13-12-23-10-5-11-23/h4,6-9,14-15H,3,5,10-13,16H2,1-2H3 |
| InChIKey | AQBUOWKCWUSTJN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |