C31H39FN2O3 — CID 163708164
6-[2-[ethyl-[[3-fluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]amino]-4-hydroxyphenyl]-1,2,5,6,7,8-hexahydronaphthalen-2-ol (PubChem CID 163708164) has the molecular formula C31H39FN2O3 and a molecular weight of 506.66 g/mol. Its IUPAC name is 6-[2-[ethyl-[[3-fluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]amino]-4-hydroxyphenyl]-1,2,5,6,7,8-hexahydronaphthalen-2-ol.
| Compound Name | 6-[2-[ethyl-[[3-fluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]amino]-4-hydroxyphenyl]-1,2,5,6,7,8-hexahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 163708164 |
| Molecular Formula | C31H39FN2O3 |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 6-[2-[ethyl-[[3-fluoro-4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]amino]-4-hydroxyphenyl]-1,2,5,6,7,8-hexahydronaphthalen-2-ol |
| SMILES | CCN(Cc1ccc(OCCN2CCCC2)c(F)c1)c1cc(O)ccc1C1CCC2=C(C=CC(O)C2)C1 |
| InChI | InChI=1S/C31H39FN2O3/c1-2-34(21-22-5-12-31(29(32)17-22)37-16-15-33-13-3-4-14-33)30-20-27(36)10-11-28(30)25-7-6-24-19-26(35)9-8-23(24)18-25/h5,8-12,17,20,25-26,35-36H,2-4,6-7,13-16,18-19,21H2,1H3 |
| InChIKey | KGWMVMMNEIWEQM-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |