C26H42N2O4 — CID 87817788
1-[N-(2-hydroxypropyl)-4-methylanilino]propan-2-ol;4-methyl-N,N-dipropoxyaniline (PubChem CID 87817788) has the molecular formula C26H42N2O4 and a molecular weight of 446.63 g/mol. Its IUPAC name is 1-[N-(2-hydroxypropyl)-4-methylanilino]propan-2-ol;4-methyl-N,N-dipropoxyaniline.
| Compound Name | 1-[N-(2-hydroxypropyl)-4-methylanilino]propan-2-ol;4-methyl-N,N-dipropoxyaniline |
|---|---|
| PubChem CID | 87817788 |
| Molecular Formula | C26H42N2O4 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.31 |
| IUPAC Name | 1-[N-(2-hydroxypropyl)-4-methylanilino]propan-2-ol;4-methyl-N,N-dipropoxyaniline |
| SMILES | CCCON(OCCC)c1ccc(C)cc1.Cc1ccc(N(CC(C)O)CC(C)O)cc1 |
| InChI | InChI=1S/2C13H21NO2/c1-10-4-6-13(7-5-10)14(8-11(2)15)9-12(3)16;1-4-10-15-14(16-11-5-2)13-8-6-12(3)7-9-13/h4-7,11-12,15-16H,8-9H2,1-3H3;6-9H,4-5,10-11H2,1-3H3 |
| InChIKey | GVLFIMTWATXKIA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|