C49H54N2O8 — CID 59516734
2-[4-[[4-[bis[2-hydroxy-2-(4-methylphenoxy)ethyl]amino]phenyl]methyl]-N-[2-hydroxy-2-(4-methylphenoxy)ethyl]anilino]-1-(4-methylphenoxy)ethanol (PubChem CID 59516734) has the molecular formula C49H54N2O8 and a molecular weight of 798.98 g/mol. Its IUPAC name is 2-[4-[[4-[bis[2-hydroxy-2-(4-methylphenoxy)ethyl]amino]phenyl]methyl]-N-[2-hydroxy-2-(4-methylphenoxy)ethyl]anilino]-1-(4-methylphenoxy)ethanol.
| Compound Name | 2-[4-[[4-[bis[2-hydroxy-2-(4-methylphenoxy)ethyl]amino]phenyl]methyl]-N-[2-hydroxy-2-(4-methylphenoxy)ethyl]anilino]-1-(4-methylphenoxy)ethanol |
|---|---|
| PubChem CID | 59516734 |
| Molecular Formula | C49H54N2O8 |
| Molecular Weight | 798.98 g/mol |
| Exact Mass | 798.39 |
| IUPAC Name | 2-[4-[[4-[bis[2-hydroxy-2-(4-methylphenoxy)ethyl]amino]phenyl]methyl]-N-[2-hydroxy-2-(4-methylphenoxy)ethyl]anilino]-1-(4-methylphenoxy)ethanol |
| SMILES | Cc1ccc(OC(O)CN(CC(O)Oc2ccc(C)cc2)c2ccc(Cc3ccc(N(CC(O)Oc4ccc(C)cc4)CC(O)Oc4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C49H54N2O8/c1-34-5-21-42(22-6-34)56-46(52)30-50(31-47(53)57-43-23-7-35(2)8-24-43)40-17-13-38(14-18-40)29-39-15-19-41(20-16-39)51(32-48(54)58-44-25-9-36(3)10-26-44)33-49(55)59-45-27-11-37(4)12-28-45/h5-28,46-49,52-55H,29-33H2,1-4H3 |
| InChIKey | IPNPJPZAKPIHHO-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.98 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|