C13H21K2NO8S2 — CID 173160114
CID 173160114 (PubChem CID 173160114) has the molecular formula C13H21K2NO8S2 and a molecular weight of 461.64 g/mol.
| Compound Name | CID 173160114 |
|---|---|
| PubChem CID | 173160114 |
| Molecular Formula | C13H21K2NO8S2 |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.00 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1N(CC(O)CS(=O)(=O)O)CC(O)CS(=O)(=O)O.[K].[K] |
| InChI | InChI=1S/C13H21NO8S2.2K/c1-10-4-2-3-5-13(10)14(6-11(15)8-23(17,18)19)7-12(16)9-24(20,21)22;;/h2-5,11-12,15-16H,6-9H2,1H3,(H,17,18,19)(H,20,21,22);; |
| InChIKey | USLBKFHKFSZMJN-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|