C13H15Br2N — CID 11313957
N,N-bis(2-bromoprop-2-enyl)-4-methylaniline (PubChem CID 11313957) has the molecular formula C13H15Br2N and a molecular weight of 345.08 g/mol. Its IUPAC name is N,N-bis(2-bromoprop-2-enyl)-4-methylaniline.
| Compound Name | N,N-bis(2-bromoprop-2-enyl)-4-methylaniline |
|---|---|
| PubChem CID | 11313957 |
| Molecular Formula | C13H15Br2N |
| Molecular Weight | 345.08 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | N,N-bis(2-bromoprop-2-enyl)-4-methylaniline |
| SMILES | C=C(Br)CN(CC(=C)Br)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H15Br2N/c1-10-4-6-13(7-5-10)16(8-11(2)14)9-12(3)15/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | PZENYCYWBPOBMU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.08 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|