C13H16F3NO2 — CID 103773405
2-[(N-ethyl-4-methylanilino)methyl]-3,3,3-trifluoropropanoic acid (PubChem CID 103773405) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-[(N-ethyl-4-methylanilino)methyl]-3,3,3-trifluoropropanoic acid.
| Compound Name | 2-[(N-ethyl-4-methylanilino)methyl]-3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 103773405 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-[(N-ethyl-4-methylanilino)methyl]-3,3,3-trifluoropropanoic acid |
| SMILES | CCN(CC(C(=O)O)C(F)(F)F)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H16F3NO2/c1-3-17(10-6-4-9(2)5-7-10)8-11(12(18)19)13(14,15)16/h4-7,11H,3,8H2,1-2H3,(H,18,19) |
| InChIKey | DBTICAFQLAFUDT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|