C16H26N2 — CID 62437096
N-cyclopropyl-N'-ethyl-2-methyl-N'-(4-methylphenyl)propane-1,3-diamine (PubChem CID 62437096) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N-cyclopropyl-N'-ethyl-2-methyl-N'-(4-methylphenyl)propane-1,3-diamine.
| Compound Name | N-cyclopropyl-N'-ethyl-2-methyl-N'-(4-methylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 62437096 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N-cyclopropyl-N'-ethyl-2-methyl-N'-(4-methylphenyl)propane-1,3-diamine |
| SMILES | CCN(CC(C)CNC1CC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H26N2/c1-4-18(16-9-5-13(2)6-10-16)12-14(3)11-17-15-7-8-15/h5-6,9-10,14-15,17H,4,7-8,11-12H2,1-3H3 |
| InChIKey | DFKJIWGMQSHNKB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|