C12H13F3N2 — CID 103367670
2-[(N-ethylanilino)methyl]-3,3,3-trifluoropropanenitrile (PubChem CID 103367670) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-[(N-ethylanilino)methyl]-3,3,3-trifluoropropanenitrile.
| Compound Name | 2-[(N-ethylanilino)methyl]-3,3,3-trifluoropropanenitrile |
|---|---|
| PubChem CID | 103367670 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 2-[(N-ethylanilino)methyl]-3,3,3-trifluoropropanenitrile |
| SMILES | CCN(CC(C#N)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H13F3N2/c1-2-17(11-6-4-3-5-7-11)9-10(8-16)12(13,14)15/h3-7,10H,2,9H2,1H3 |
| InChIKey | XOJCQNFGJRFENF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |