C11H15F3N2 — CID 43752644
2-N-ethyl-3,3,3-trifluoro-2-N-phenylpropane-1,2-diamine (PubChem CID 43752644) has the molecular formula C11H15F3N2 and a molecular weight of 232.25 g/mol. Its IUPAC name is 2-N-ethyl-3,3,3-trifluoro-2-N-phenylpropane-1,2-diamine.
| Compound Name | 2-N-ethyl-3,3,3-trifluoro-2-N-phenylpropane-1,2-diamine |
|---|---|
| PubChem CID | 43752644 |
| Molecular Formula | C11H15F3N2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-N-ethyl-3,3,3-trifluoro-2-N-phenylpropane-1,2-diamine |
| SMILES | CCN(c1ccccc1)C(CN)C(F)(F)F |
| InChI | InChI=1S/C11H15F3N2/c1-2-16(9-6-4-3-5-7-9)10(8-15)11(12,13)14/h3-7,10H,2,8,15H2,1H3 |
| InChIKey | PIDAPERCVQDKLO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |