C11H19ClN2 — CID 19706422
1-N'-ethyl-1-N'-phenylpropane-1,1-diamine;hydrochloride (PubChem CID 19706422) has the molecular formula C11H19ClN2 and a molecular weight of 214.74 g/mol. Its IUPAC name is 1-N'-ethyl-1-N'-phenylpropane-1,1-diamine;hydrochloride.
| Compound Name | 1-N'-ethyl-1-N'-phenylpropane-1,1-diamine;hydrochloride |
|---|---|
| PubChem CID | 19706422 |
| Molecular Formula | C11H19ClN2 |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-N'-ethyl-1-N'-phenylpropane-1,1-diamine;hydrochloride |
| SMILES | CCC(N)N(CC)c1ccccc1.Cl |
| InChI | InChI=1S/C11H18N2.ClH/c1-3-11(12)13(4-2)10-8-6-5-7-9-10;/h5-9,11H,3-4,12H2,1-2H3;1H |
| InChIKey | RULRNYDXAJYAON-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|