C11H17NO2 — CID 124514584
(1S)-1-(N-ethylanilino)propane-1,3-diol (PubChem CID 124514584) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (1S)-1-(N-ethylanilino)propane-1,3-diol.
| Compound Name | (1S)-1-(N-ethylanilino)propane-1,3-diol |
|---|---|
| PubChem CID | 124514584 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (1S)-1-(N-ethylanilino)propane-1,3-diol |
| SMILES | CCN(c1ccccc1)[C@@H](O)CCO |
| InChI | InChI=1S/C11H17NO2/c1-2-12(11(14)8-9-13)10-6-4-3-5-7-10/h3-7,11,13-14H,2,8-9H2,1H3/t11-/m0/s1 |
| InChIKey | GOOASSUTTPLVES-NSHDSACASA-N |
| XLogP | 1.21 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|