C13H19F3N2 — CID 103366107
N'-benzyl-N'-ethyl-2-(trifluoromethyl)propane-1,3-diamine (PubChem CID 103366107) has the molecular formula C13H19F3N2 and a molecular weight of 260.30 g/mol. Its IUPAC name is N'-benzyl-N'-ethyl-2-(trifluoromethyl)propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-ethyl-2-(trifluoromethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 103366107 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N'-benzyl-N'-ethyl-2-(trifluoromethyl)propane-1,3-diamine |
| SMILES | CCN(Cc1ccccc1)CC(CN)C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2/c1-2-18(9-11-6-4-3-5-7-11)10-12(8-17)13(14,15)16/h3-7,12H,2,8-10,17H2,1H3 |
| InChIKey | HOOIBDNZUXZWFH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |