C17H18F3NO — CID 1488046
(2R)-3-(dibenzylamino)-1,1,1-trifluoropropan-2-ol (PubChem CID 1488046) has the molecular formula C17H18F3NO and a molecular weight of 309.33 g/mol. Its IUPAC name is (2R)-3-(dibenzylamino)-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2R)-3-(dibenzylamino)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 1488046 |
| Molecular Formula | C17H18F3NO |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (2R)-3-(dibenzylamino)-1,1,1-trifluoropropan-2-ol |
| SMILES | O[C@H](CN(Cc1ccccc1)Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H18F3NO/c18-17(19,20)16(22)13-21(11-14-7-3-1-4-8-14)12-15-9-5-2-6-10-15/h1-10,16,22H,11-13H2/t16-/m1/s1 |
| InChIKey | WMHVXNPTZAJEOB-MRXNPFEDSA-N |
| XLogP | 3.61 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |