C16H15F4NO — CID 10805120
3-(N-benzyl-3-fluoroanilino)-1,1,1-trifluoropropan-2-ol (PubChem CID 10805120) has the molecular formula C16H15F4NO and a molecular weight of 313.29 g/mol. Its IUPAC name is 3-(N-benzyl-3-fluoroanilino)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(N-benzyl-3-fluoroanilino)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 10805120 |
| Molecular Formula | C16H15F4NO |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-(N-benzyl-3-fluoroanilino)-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(CN(Cc1ccccc1)c1cccc(F)c1)C(F)(F)F |
| InChI | InChI=1S/C16H15F4NO/c17-13-7-4-8-14(9-13)21(11-15(22)16(18,19)20)10-12-5-2-1-3-6-12/h1-9,15,22H,10-11H2 |
| InChIKey | JIADVIXXPMXDSB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |