C11H11F3N2O — CID 103366982
3,3,3-trifluoro-2-[(3-methoxyanilino)methyl]propanenitrile (PubChem CID 103366982) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(3-methoxyanilino)methyl]propanenitrile.
| Compound Name | 3,3,3-trifluoro-2-[(3-methoxyanilino)methyl]propanenitrile |
|---|---|
| PubChem CID | 103366982 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3,3,3-trifluoro-2-[(3-methoxyanilino)methyl]propanenitrile |
| SMILES | COc1cccc(NCC(C#N)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3N2O/c1-17-10-4-2-3-9(5-10)16-7-8(6-15)11(12,13)14/h2-5,8,16H,7H2,1H3 |
| InChIKey | RIXPDDMVDLAHAQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |