C13H18N2O — CID 60990481
2-(3-methoxyanilino)-2,3-dimethylbutanenitrile (PubChem CID 60990481) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(3-methoxyanilino)-2,3-dimethylbutanenitrile.
| Compound Name | 2-(3-methoxyanilino)-2,3-dimethylbutanenitrile |
|---|---|
| PubChem CID | 60990481 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-(3-methoxyanilino)-2,3-dimethylbutanenitrile |
| SMILES | COc1cccc(NC(C)(C#N)C(C)C)c1 |
| InChI | InChI=1S/C13H18N2O/c1-10(2)13(3,9-14)15-11-6-5-7-12(8-11)16-4/h5-8,10,15H,1-4H3 |
| InChIKey | ONJRAVJSZBMGGU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |