C14H30O2 — CID 175277309
5-tert-butyl-7,7-dimethyloctane-1,6-diol (PubChem CID 175277309) has the molecular formula C14H30O2 and a molecular weight of 230.39 g/mol. Its IUPAC name is 5-tert-butyl-7,7-dimethyloctane-1,6-diol.
| Compound Name | 5-tert-butyl-7,7-dimethyloctane-1,6-diol |
|---|---|
| PubChem CID | 175277309 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 5-tert-butyl-7,7-dimethyloctane-1,6-diol |
| SMILES | CC(C)(C)C(O)C(CCCCO)C(C)(C)C |
| InChI | InChI=1S/C14H30O2/c1-13(2,3)11(9-7-8-10-15)12(16)14(4,5)6/h11-12,15-16H,7-10H2,1-6H3 |
| InChIKey | VWZWPZWYKLNJFJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|