About 3,4-ditert-butylhexane-1,6-diol
3,4-ditert-butylhexane-1,6-diol (PubChem CID 174460247) has the molecular formula C14H30O2
and a molecular weight of 230.39 g/mol. Its IUPAC name is 3,4-ditert-butylhexane-1,6-diol.
Molecular Properties
| Compound Name | 3,4-ditert-butylhexane-1,6-diol |
| PubChem CID | 174460247 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 3,4-ditert-butylhexane-1,6-diol |
| SMILES | CC(C)(C)C(CCO)C(CCO)C(C)(C)C |
| InChI | InChI=1S/C14H30O2/c1-13(2,3)11(7-9-15)12(8-10-16)14(4,5)6/h11-12,15-16H,7-10H2,1-6H3 |
| InChIKey | QZDWDYKZXCTMHV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-ditert-butylhexane-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-ditert-butylhexane-1,6-diol?
The IUPAC name of 3,4-ditert-butylhexane-1,6-diol (CID 174460247) is 3,4-ditert-butylhexane-1,6-diol.
What is the SMILES notation for 3,4-ditert-butylhexane-1,6-diol?
The canonical SMILES for 3,4-ditert-butylhexane-1,6-diol is CC(C)(C)C(CCO)C(CCO)C(C)(C)C.
What is the InChIKey of 3,4-ditert-butylhexane-1,6-diol?
The InChIKey is QZDWDYKZXCTMHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O2/c1-13(2,3)11(7-9-15)12(8-10-16)14(4,5)6/h11-12,15-16H,7-10H2,1-6H3.
What are the key properties of 3,4-ditert-butylhexane-1,6-diol?
3,4-ditert-butylhexane-1,6-diol has a molecular weight of 230.39 g/mol, XLogP of 3.08, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-ditert-butylhexane-1,6-diol is sourced from PubChem (CID 174460247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).