C13H27NO6 — CID 89329611
3-[[1,1,3-trihydroxy-4-(2-hydroxyethyl)-5,5-dimethylhexan-2-yl]amino]propanoic acid (PubChem CID 89329611) has the molecular formula C13H27NO6 and a molecular weight of 293.36 g/mol. Its IUPAC name is 3-[[1,1,3-trihydroxy-4-(2-hydroxyethyl)-5,5-dimethylhexan-2-yl]amino]propanoic acid.
| Compound Name | 3-[[1,1,3-trihydroxy-4-(2-hydroxyethyl)-5,5-dimethylhexan-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 89329611 |
| Molecular Formula | C13H27NO6 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 3-[[1,1,3-trihydroxy-4-(2-hydroxyethyl)-5,5-dimethylhexan-2-yl]amino]propanoic acid |
| SMILES | CC(C)(C)C(CCO)C(O)C(NCCC(=O)O)C(O)O |
| InChI | InChI=1S/C13H27NO6/c1-13(2,3)8(5-7-15)11(18)10(12(19)20)14-6-4-9(16)17/h8,10-12,14-15,18-20H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | SPDMSCRYNUBULO-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|