C7H13NO5 — CID 102529377
3-[[(2R)-2,4-dihydroxybutanoyl]amino]propanoic acid (PubChem CID 102529377) has the molecular formula C7H13NO5 and a molecular weight of 191.18 g/mol. Its IUPAC name is 3-[[(2R)-2,4-dihydroxybutanoyl]amino]propanoic acid.
| Compound Name | 3-[[(2R)-2,4-dihydroxybutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 102529377 |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 3-[[(2R)-2,4-dihydroxybutanoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)[C@H](O)CCO |
| InChI | InChI=1S/C7H13NO5/c9-4-2-5(10)7(13)8-3-1-6(11)12/h5,9-10H,1-4H2,(H,8,13)(H,11,12)/t5-/m1/s1 |
| InChIKey | NVBRLCCDSDVDDO-RXMQYKEDSA-N |
| XLogP | -1.68 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |