About (2R)-2,4-dihydroxy-N-prop-2-ynylbutanamide
(2R)-2,4-dihydroxy-N-prop-2-ynylbutanamide (PubChem CID 131230147) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is (2R)-2,4-dihydroxy-N-prop-2-ynylbutanamide.
Molecular Properties
| Compound Name | (2R)-2,4-dihydroxy-N-prop-2-ynylbutanamide |
| PubChem CID | 131230147 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (2R)-2,4-dihydroxy-N-prop-2-ynylbutanamide |
| SMILES | C#CCNC(=O)[C@H](O)CCO |
| InChI | InChI=1S/C7H11NO3/c1-2-4-8-7(11)6(10)3-5-9/h1,6,9-10H,3-5H2,(H,8,11)/t6-/m1/s1 |
| InChIKey | DRFQYESFWWYINM-ZCFIWIBFSA-N |
| XLogP | -1.52 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2,4-dihydroxy-N-prop-2-ynylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,4-dihydroxy-N-prop-2-ynylbutanamide?
The IUPAC name of (2R)-2,4-dihydroxy-N-prop-2-ynylbutanamide (CID 131230147) is (2R)-2,4-dihydroxy-N-prop-2-ynylbutanamide.
What is the SMILES notation for (2R)-2,4-dihydroxy-N-prop-2-ynylbutanamide?
The canonical SMILES for (2R)-2,4-dihydroxy-N-prop-2-ynylbutanamide is C#CCNC(=O)[C@H](O)CCO.
What is the InChIKey of (2R)-2,4-dihydroxy-N-prop-2-ynylbutanamide?
The InChIKey is DRFQYESFWWYINM-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H11NO3/c1-2-4-8-7(11)6(10)3-5-9/h1,6,9-10H,3-5H2,(H,8,11)/t6-/m1/s1.
What are the key properties of (2R)-2,4-dihydroxy-N-prop-2-ynylbutanamide?
(2R)-2,4-dihydroxy-N-prop-2-ynylbutanamide has a molecular weight of 157.17 g/mol, XLogP of -1.52, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,4-dihydroxy-N-prop-2-ynylbutanamide is sourced from PubChem (CID 131230147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).