C11H16O8 — CID 141076464
[(2R,3S,4R)-3,4-bis[(2-deuterioacetyl)oxy]-2-hydroxy-5-oxopentyl] 2-deuterioacetate (PubChem CID 141076464) has the molecular formula C11H16O8 and a molecular weight of 279.26 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-bis[(2-deuterioacetyl)oxy]-2-hydroxy-5-oxopentyl] 2-deuterioacetate.
| Compound Name | [(2R,3S,4R)-3,4-bis[(2-deuterioacetyl)oxy]-2-hydroxy-5-oxopentyl] 2-deuterioacetate |
|---|---|
| PubChem CID | 141076464 |
| Molecular Formula | C11H16O8 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | [(2R,3S,4R)-3,4-bis[(2-deuterioacetyl)oxy]-2-hydroxy-5-oxopentyl] 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@@H](O)[C@H](OC(=O)C[2H])[C@H](C=O)OC(=O)C[2H] |
| InChI | InChI=1S/C11H16O8/c1-6(13)17-5-9(16)11(19-8(3)15)10(4-12)18-7(2)14/h4,9-11,16H,5H2,1-3H3/t9-,10+,11+/m1/s1/i1D,2D,3D |
| InChIKey | XKMJGSIAPCXTJN-CYUGMVOHSA-N |
| XLogP | -1.03 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|