C11H16O7 — CID 141246395
[(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-oxopentan-2-yl] 2-deuterioacetate (PubChem CID 141246395) has the molecular formula C11H16O7 and a molecular weight of 263.26 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-oxopentan-2-yl] 2-deuterioacetate.
| Compound Name | [(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-oxopentan-2-yl] 2-deuterioacetate |
|---|---|
| PubChem CID | 141246395 |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | [(2R,3R,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-oxopentan-2-yl] 2-deuterioacetate |
| SMILES | [2H]CC(=O)O[C@@H]([C@H](C=O)OC(=O)C[2H])[C@@H](C)OC(=O)C[2H] |
| InChI | InChI=1S/C11H16O7/c1-6(16-7(2)13)11(18-9(4)15)10(5-12)17-8(3)14/h5-6,10-11H,1-4H3/t6-,10+,11-/m1/s1/i2D,3D,4D |
| InChIKey | CMIDSMWYINFXDB-QRSKJLHJSA-N |
| XLogP | 0.00 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|