C10H17NO5 — CID 131863910
[(2S,3R,4S)-4-acetamido-2-hydroxy-6-oxohexan-3-yl] acetate (PubChem CID 131863910) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is [(2S,3R,4S)-4-acetamido-2-hydroxy-6-oxohexan-3-yl] acetate.
| Compound Name | [(2S,3R,4S)-4-acetamido-2-hydroxy-6-oxohexan-3-yl] acetate |
|---|---|
| PubChem CID | 131863910 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | [(2S,3R,4S)-4-acetamido-2-hydroxy-6-oxohexan-3-yl] acetate |
| SMILES | CC(=O)N[C@@H](CC=O)[C@@H](OC(C)=O)[C@H](C)O |
| InChI | InChI=1S/C10H17NO5/c1-6(13)10(16-8(3)15)9(4-5-12)11-7(2)14/h5-6,9-10,13H,4H2,1-3H3,(H,11,14)/t6-,9-,10-/m0/s1 |
| InChIKey | SAQRAPFGWCEJGL-JUWDTYFHSA-N |
| XLogP | -0.61 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|