C9H18N2O5 — CID 131852383
N-[(2S,3S,4S)-1-acetamido-2,3,4-trihydroxypentyl]acetamide (PubChem CID 131852383) has the molecular formula C9H18N2O5 and a molecular weight of 234.25 g/mol. Its IUPAC name is N-[(2S,3S,4S)-1-acetamido-2,3,4-trihydroxypentyl]acetamide.
| Compound Name | N-[(2S,3S,4S)-1-acetamido-2,3,4-trihydroxypentyl]acetamide |
|---|---|
| PubChem CID | 131852383 |
| Molecular Formula | C9H18N2O5 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-[(2S,3S,4S)-1-acetamido-2,3,4-trihydroxypentyl]acetamide |
| SMILES | CC(=O)NC(NC(C)=O)[C@H](O)[C@@H](O)[C@H](C)O |
| InChI | InChI=1S/C9H18N2O5/c1-4(12)7(15)8(16)9(10-5(2)13)11-6(3)14/h4,7-9,12,15-16H,1-3H3,(H,10,13)(H,11,14)/t4-,7-,8+/m0/s1 |
| InChIKey | SLZUHLYCZMWBOR-ZQASAOEGSA-N |
| XLogP | -2.31 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|