C16H25NO9 — CID 558695
(2-acetamido-3,4,5-triacetyloxyhexyl) acetate (PubChem CID 558695) has the molecular formula C16H25NO9 and a molecular weight of 375.37 g/mol. Its IUPAC name is (2-acetamido-3,4,5-triacetyloxyhexyl) acetate.
| Compound Name | (2-acetamido-3,4,5-triacetyloxyhexyl) acetate |
|---|---|
| PubChem CID | 558695 |
| Molecular Formula | C16H25NO9 |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (2-acetamido-3,4,5-triacetyloxyhexyl) acetate |
| SMILES | CC(=O)NC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C(C)OC(C)=O |
| InChI | InChI=1S/C16H25NO9/c1-8(24-11(4)20)15(25-12(5)21)16(26-13(6)22)14(17-9(2)18)7-23-10(3)19/h8,14-16H,7H2,1-6H3,(H,17,18) |
| InChIKey | HEZIWZQSGOXISL-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|