About 1-(benzenesulfonyl)propan-2-yl (2,5-dihydroxypyrrol-1-yl) carbonate
1-(benzenesulfonyl)propan-2-yl (2,5-dihydroxypyrrol-1-yl) carbonate (PubChem CID 123837591) has the molecular formula C14H15NO7S
and a molecular weight of 341.34 g/mol. Its IUPAC name is 1-(benzenesulfonyl)propan-2-yl (2,5-dihydroxypyrrol-1-yl) carbonate.
Analyze 1-(benzenesulfonyl)propan-2-yl (2,5-dihydroxypyrrol-1-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)propan-2-yl (2,5-dihydroxypyrrol-1-yl) carbonate?
The IUPAC name of 1-(benzenesulfonyl)propan-2-yl (2,5-dihydroxypyrrol-1-yl) carbonate (CID 123837591) is 1-(benzenesulfonyl)propan-2-yl (2,5-dihydroxypyrrol-1-yl) carbonate.
What is the SMILES notation for 1-(benzenesulfonyl)propan-2-yl (2,5-dihydroxypyrrol-1-yl) carbonate?
The canonical SMILES for 1-(benzenesulfonyl)propan-2-yl (2,5-dihydroxypyrrol-1-yl) carbonate is CC(CS(=O)(=O)c1ccccc1)OC(=O)On1c(O)ccc1O.
What is the InChIKey of 1-(benzenesulfonyl)propan-2-yl (2,5-dihydroxypyrrol-1-yl) carbonate?
The InChIKey is GSVWYWLMFHBHIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO7S/c1-10(9-23(19,20)11-5-3-2-4-6-11)21-14(18)22-15-12(16)7-8-13(15)17/h2-8,10,16-17H,9H2,1H3.
What are the key properties of 1-(benzenesulfonyl)propan-2-yl (2,5-dihydroxypyrrol-1-yl) carbonate?
1-(benzenesulfonyl)propan-2-yl (2,5-dihydroxypyrrol-1-yl) carbonate has a molecular weight of 341.34 g/mol, XLogP of 1.33, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)propan-2-yl (2,5-dihydroxypyrrol-1-yl) carbonate is sourced from PubChem (CID 123837591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).