C16H17NO7 — CID 91543114
[1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] benzoate (PubChem CID 91543114) has the molecular formula C16H17NO7 and a molecular weight of 335.31 g/mol. Its IUPAC name is [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] benzoate.
| Compound Name | [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] benzoate |
|---|---|
| PubChem CID | 91543114 |
| Molecular Formula | C16H17NO7 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] benzoate |
| SMILES | CC(C)C(OC(=O)On1c(O)ccc1O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO7/c1-10(2)15(22-14(20)11-6-4-3-5-7-11)23-16(21)24-17-12(18)8-9-13(17)19/h3-10,15,18-19H,1-2H3 |
| InChIKey | QBKRNZUWVMESAP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|