C10H15NO5 — CID 91162639
(2,5-dihydroxypyrrol-1-yl) 4-methoxy-2-methylbutanoate (PubChem CID 91162639) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-methoxy-2-methylbutanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-methoxy-2-methylbutanoate |
|---|---|
| PubChem CID | 91162639 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-methoxy-2-methylbutanoate |
| SMILES | COCCC(C)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C10H15NO5/c1-7(5-6-15-2)10(14)16-11-8(12)3-4-9(11)13/h3-4,7,12-13H,5-6H2,1-2H3 |
| InChIKey | GARNKFJVMOBXFL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |