C20H29NO4Si — CID 123456386
(2,5-dihydroxypyrrol-1-yl) 2-[4-[bis(2-methylpropyl)silyl]phenyl]acetate (PubChem CID 123456386) has the molecular formula C20H29NO4Si and a molecular weight of 375.54 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[4-[bis(2-methylpropyl)silyl]phenyl]acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[4-[bis(2-methylpropyl)silyl]phenyl]acetate |
|---|---|
| PubChem CID | 123456386 |
| Molecular Formula | C20H29NO4Si |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[4-[bis(2-methylpropyl)silyl]phenyl]acetate |
| SMILES | CC(C)C[SiH](CC(C)C)c1ccc(CC(=O)On2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C20H29NO4Si/c1-14(2)12-26(13-15(3)4)17-7-5-16(6-8-17)11-20(24)25-21-18(22)9-10-19(21)23/h5-10,14-15,22-23,26H,11-13H2,1-4H3 |
| InChIKey | ZGITZRYOFDJCSS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|