C11H12N2O4 — CID 91566809
(2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate (PubChem CID 91566809) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate |
|---|---|
| PubChem CID | 91566809 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate |
| SMILES | O=C(CCc1cc[nH]c1)On1c(O)ccc1O |
| InChI | InChI=1S/C11H12N2O4/c14-9-2-3-10(15)13(9)17-11(16)4-1-8-5-6-12-7-8/h2-3,5-7,12,14-15H,1,4H2 |
| InChIKey | RNBRIQYPPBLIDE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |