(2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate

C11H12N2O4 — CID 91566809

IUPAC(2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate
SMILESO=C(CCc1cc[nH]c1)On1c(O)ccc1O
InChIInChI=1S/C11H12N2O4/c14-9-2-3-10(15)13(9)17-11(16)4-1-8-5-6-12-7-8/h2-3,5-7,12,14-15H,1,4H2
InChIKeyRNBRIQYPPBLIDE-UHFFFAOYSA-N
MW236.23 g/mol
LogP0.82
Rot. Bonds4

About (2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate

(2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate (PubChem CID 91566809) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate.

Molecular Properties

Compound Name(2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate
PubChem CID91566809
Molecular FormulaC11H12N2O4
Molecular Weight236.23 g/mol
Exact Mass236.08
IUPAC Name(2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate
SMILESO=C(CCc1cc[nH]c1)On1c(O)ccc1O
InChIInChI=1S/C11H12N2O4/c14-9-2-3-10(15)13(9)17-11(16)4-1-8-5-6-12-7-8/h2-3,5-7,12,14-15H,1,4H2
InChIKeyRNBRIQYPPBLIDE-UHFFFAOYSA-N
XLogP0.82
TPSA87.48 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.23
LogP ≤ 50.82
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze (2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate (CID 91566809) is (2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate is O=C(CCc1cc[nH]c1)On1c(O)ccc1O.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate?
The InChIKey is RNBRIQYPPBLIDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O4/c14-9-2-3-10(15)13(9)17-11(16)4-1-8-5-6-12-7-8/h2-3,5-7,12,14-15H,1,4H2.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate?
(2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate has a molecular weight of 236.23 g/mol, XLogP of 0.82, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 3-(1H-pyrrol-3-yl)propanoate is sourced from PubChem (CID 91566809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).