About 4-[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]benzenesulfinate
4-[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]benzenesulfinate (PubChem CID 57087008) has the molecular formula C13H12NO6S-
and a molecular weight of 310.31 g/mol. Its IUPAC name is 4-[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]benzenesulfinate.
Molecular Properties
| Compound Name | 4-[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]benzenesulfinate |
| PubChem CID | 57087008 |
| Molecular Formula | C13H12NO6S- |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 4-[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]benzenesulfinate |
| SMILES | O=C(CCc1ccc(S(=O)[O-])cc1)On1c(O)ccc1O |
| InChI | InChI=1S/C13H13NO6S/c15-11-6-7-12(16)14(11)20-13(17)8-3-9-1-4-10(5-2-9)21(18)19/h1-2,4-7,15-16H,3,8H2,(H,18,19)/p-1 |
| InChIKey | CTBKOLFLJYKUDO-UHFFFAOYSA-M |
| XLogP | 0.73 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]benzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]benzenesulfinate?
The IUPAC name of 4-[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]benzenesulfinate (CID 57087008) is 4-[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]benzenesulfinate.
What is the SMILES notation for 4-[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]benzenesulfinate?
The canonical SMILES for 4-[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]benzenesulfinate is O=C(CCc1ccc(S(=O)[O-])cc1)On1c(O)ccc1O.
What is the InChIKey of 4-[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]benzenesulfinate?
The InChIKey is CTBKOLFLJYKUDO-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H13NO6S/c15-11-6-7-12(16)14(11)20-13(17)8-3-9-1-4-10(5-2-9)21(18)19/h1-2,4-7,15-16H,3,8H2,(H,18,19)/p-1.
What are the key properties of 4-[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]benzenesulfinate?
4-[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]benzenesulfinate has a molecular weight of 310.31 g/mol, XLogP of 0.73, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]benzenesulfinate is sourced from PubChem (CID 57087008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).