C20H18N2O6 — CID 136655429
(2,5-dihydroxypyrrol-1-yl) 3-[4-hydroxy-3-[(2-hydroxyphenyl)iminomethyl]phenyl]propanoate (PubChem CID 136655429) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[4-hydroxy-3-[(2-hydroxyphenyl)iminomethyl]phenyl]propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[4-hydroxy-3-[(2-hydroxyphenyl)iminomethyl]phenyl]propanoate |
|---|---|
| PubChem CID | 136655429 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[4-hydroxy-3-[(2-hydroxyphenyl)iminomethyl]phenyl]propanoate |
| SMILES | O=C(CCc1ccc(O)c(/C=N/c2ccccc2O)c1)On1c(O)ccc1O |
| InChI | InChI=1S/C20H18N2O6/c23-16-7-5-13(6-10-20(27)28-22-18(25)8-9-19(22)26)11-14(16)12-21-15-3-1-2-4-17(15)24/h1-5,7-9,11-12,23-26H,6,10H2/b21-12+ |
| InChIKey | LOWYSPSQGAZJGQ-CIAFOILYSA-N |
| XLogP | 2.65 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|