C16H17NO4S — CID 57035006
(2,5-dihydroxypyrrol-1-yl) 3-[(4-ethenylphenyl)methylsulfanyl]propanoate (PubChem CID 57035006) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[(4-ethenylphenyl)methylsulfanyl]propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[(4-ethenylphenyl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 57035006 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[(4-ethenylphenyl)methylsulfanyl]propanoate |
| SMILES | C=Cc1ccc(CSCCC(=O)On2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C16H17NO4S/c1-2-12-3-5-13(6-4-12)11-22-10-9-16(20)21-17-14(18)7-8-15(17)19/h2-8,18-19H,1,9-11H2 |
| InChIKey | USYPZQJECTYAQT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|