C13H10FNO4 — CID 54350533
(2,5-dihydroxypyrrol-1-yl) 3-(4-fluorophenyl)prop-2-enoate (PubChem CID 54350533) has the molecular formula C13H10FNO4 and a molecular weight of 263.22 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 54350533 |
| Molecular Formula | C13H10FNO4 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-(4-fluorophenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(F)cc1)On1c(O)ccc1O |
| InChI | InChI=1S/C13H10FNO4/c14-10-4-1-9(2-5-10)3-8-13(18)19-15-11(16)6-7-12(15)17/h1-8,16-17H |
| InChIKey | UFKCANQCYSYIGC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|