C13H11NO4 — CID 90879181
(2,5-dihydroxypyrrol-1-yl) 4-ethenylbenzoate (PubChem CID 90879181) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-ethenylbenzoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-ethenylbenzoate |
|---|---|
| PubChem CID | 90879181 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)On2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C13H11NO4/c1-2-9-3-5-10(6-4-9)13(17)18-14-11(15)7-8-12(14)16/h2-8,15-16H,1H2 |
| InChIKey | SZCOHJDILMUNBD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |