C12H9NO5 — CID 54022956
(2,5-dihydroxypyrrol-1-yl) 4-formylbenzoate (PubChem CID 54022956) has the molecular formula C12H9NO5 and a molecular weight of 247.21 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-formylbenzoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-formylbenzoate |
|---|---|
| PubChem CID | 54022956 |
| Molecular Formula | C12H9NO5 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)On2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C12H9NO5/c14-7-8-1-3-9(4-2-8)12(17)18-13-10(15)5-6-11(13)16/h1-7,15-16H |
| InChIKey | LAFFQZOCKRFKQM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|