C16H12N2O8 — CID 54481700
bis(2,5-dihydroxypyrrol-1-yl) benzene-1,4-dicarboxylate (PubChem CID 54481700) has the molecular formula C16H12N2O8 and a molecular weight of 360.28 g/mol. Its IUPAC name is bis(2,5-dihydroxypyrrol-1-yl) benzene-1,4-dicarboxylate.
| Compound Name | bis(2,5-dihydroxypyrrol-1-yl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 54481700 |
| Molecular Formula | C16H12N2O8 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | bis(2,5-dihydroxypyrrol-1-yl) benzene-1,4-dicarboxylate |
| SMILES | O=C(On1c(O)ccc1O)c1ccc(C(=O)On2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C16H12N2O8/c19-11-5-6-12(20)17(11)25-15(23)9-1-2-10(4-3-9)16(24)26-18-13(21)7-8-14(18)22/h1-8,19-22H |
| InChIKey | XPLDWCRRRASGRN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |